Đề thi thử tốt nghiệp Trung học phổ thông Quốc gia năm 2023 môn Hóa học - Đề số 2

docx 4 trang Phương Ly 06/07/2023 4120
Bạn đang xem tài liệu "Đề thi thử tốt nghiệp Trung học phổ thông Quốc gia năm 2023 môn Hóa học - Đề số 2", để tải tài liệu gốc về máy hãy click vào nút Download ở trên.

File đính kèm:

  • docxde_thi_thu_tot_nghiep_trung_hoc_pho_thong_quoc_gia_nam_2023.docx

Nội dung text: Đề thi thử tốt nghiệp Trung học phổ thông Quốc gia năm 2023 môn Hóa học - Đề số 2

  1. ĐỀ THI THỬ THPT QUỐC GIA NĂM 2023 ĐỀ MINH HỌA CHUẨN 2023 Bài thi: KHOA HỌC TỰ NHIÊN ĐỀ SỐ 2 Môn thi thành phần: HÓA HỌC Thời gian làm bài: 50 phút, không kể thời gian phát đề Họ, tên thí sinh: Số báo danh: * Cho biết nguyên tử khối của các nguyên tố: H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Mn = 55; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137. * Các thể tích khí đều đo ở điều kiện tiêu chuẩn, giả thiết các khí sinh ra không tan trong nước. Câu 1:(NB) Natri (Na) phản ứng với nước sinh ra sản phẩm nào sau đây? A. Na2O. B. NaCl. C. NaClO3. D. NaOH. Câu 2:(NB) Dung dịch chất nào sau đây hòa tan được Al2O3? A. KCl.B. H 2SO4. C. BaCl2. D. Cu(NO3)2. Câu 3:(NB) Ở điều kiện thường, chất nào sau đây là chất rắn? A. Metyl fomat.B. Etanol. C. Glyxin. D. Metylamin. Câu 4:(NB) Cho thanh kim loại Fe vào dung dịch chất nào sau đây sẽ xảy ra hiện tượng ăn mòn hóa học? A. KCl.B. HCl. C. AgNO 3. D. NaOH. Câu 5:(NB) Nước cứng tạm thời tác dụng với chất nào sau đây thu được kết tủa? A. NaNO3.B. Na 3PO4. C. NaCl. D. HCl. Câu 6:(NB) Trong điều kiện không có oxi, sắt phản ứng với lượng dư chất nào sau đây ở điều kiện thích hợp sinh ra muối sắt(II)? A. H2SO4 đặc, nóng.B. HNO 3 loãng. C. Cl2. D. S. Câu 7:(TH) Trong phản ứng của kim loại K với khí Cl 2, một nguyên tử K nhường bao nhiêu electron? A. 1. B. 3. C. 4. D. 2. Câu 8:(NB) Este CH3COOC2H5 có tên gọi là A. Etyl axetat.B. Metyl axetat. C. Etyl fomat. D. Metyl propionat. Câu 9:(TH) Điện phân nóng chảy MgCl2, ở anot thu được chất nào sau đây? A. HCl.B. Cl 2. C. Mg. D. Mg(OH)2. Câu 10:(NB) Tơ đươc sản xuất từ xenlulozơ là A. Tơ nilon-6,6B. Tơ tằmC. Tơ capronD. Tơ visco Câu 11:(NB) Chất nào sau đây là chất điện ly mạnh khi tan trong nước? A. HCl.B. H 2S. C. HF. D. HClO. Câu 12:(NB) Nhiệt độ nóng chảy của kim loại nhôm là A. 6600C B. 20500CC. 1540 0C D. 10000C Câu 13:(NB) Chất có thể gây nghiện cho con người nếu sử dụng thường xuyên là A. heroin. B. paradol. C. ampixilin. D. amoxilin. Câu 14:(NB) Ở điều kiện thường, chất béo nào sau đây tồn tại ở trạng thái rắn? A. C17H33COOC3H5(OOCC17H31)2. B. C3H5(OOCC17H35)3. C. C3H5(OOCC17H33)3. D. C3H5(OOCC17H31)3. Câu 15:(NB) Kim loại nào sau đây có nhiệt độ nóng chảy cao nhất?
  2. A. Na. B. W. C. Fe. D. Al. Câu 16:(NB) Người ta dùng đèn xì oxi – axetilen để hàn và cắt kim loại. Công thức phân tử của axetilen là A. CH4. B. C2H4. C. C2H2. D. C6H6. Câu 17:(NB) Chất nào sau đây là amin bậc ba? A. CH3NH2.B. (CH 3)2NH. C. (C2H5)3N. D. C6H5NH2. Câu 18:(NB) Các số oxi hoá đặc trưng của crom là A. +2; +4, +6.B. +2, +3, +6. C. +1, +2, +4, +6. D. +3, +4, +6. Câu 19:(NB) Kim loại nào được điều chế bằng phương pháp điện phân nóng chảy? A. Na. B. Cu. C. Fe. D. Ag. Câu 20:(NB) Dung dịch chất nào sau đây có pH < 7? A. Saccarozơ. B. Etylamin. C. Axit glutamic. D. Lysin. Câu 21:(VD) Hòa tan hoàn toàn 4,32 gam hỗn hợp X gồm FeO, MgO và ZnO bằng một lượng vừa đủ 150 ml dung dịch HCl 1M, thu được dung dịch chứa m gam muối. Giá trị của m là A. 9,795. B. 7,095. C. 7,995. D. 8,445. Câu 22:(TH) Dãy chất thuộc loại polime thiên nhiên là A. nilon - 6, polietilen, xenlulozơ.B. nilon - 6, tơ tằm, polistiren. C. tinh bột, xenlulozơ, tơ tằm. D. tơ nitron, tơ axetat, tinh bột. Câu 23:(TH) Câu nào trong các câu dưới đây không đúng? A. Cu tan trong dung dịch HNO3 loãng. B. Fe tan trong dung dịch HCl. C. Ag tan trong dung dịch CuCl2. D. Fe tan trong dung dịch CuSO4. Câu 24:(VD) Lên men rượu m gam tinh bột thu được V lít CO 2 (đktc). Toàn bộ lượng CO 2 sinh ra được hấp thụ vào dung dịch Ca(OH) 2 dư thu được 12 gam kết tủa. Biết hiệu suất quá trình lên men là 90%. Giá trị của m là A. 8,75. B. 9,72. C. 10,8. D. 43,2. Câu 25:(VD) Cho 8,24 gam amino axit X (phân tử có một nhóm -COOH và một nhóm -NH2) phản ứng với dung dịch HCl dư thì thu được 11,16 gam muối. X là A. H2N-C3H6-COOH. B. H2N-C2H4-COOH. C. H2N-C4H8-COOH. D. H2N-CH2-COOH. Câu 26:(TH) X và Y là hai cacbohiđrat. X là chất rắn, tinh thể không màu, dễ tan trong nước, có vị ngọt nhưng không ngọt bằng đường mía. Y là chất rắn dạng sợi, màu trắng, không có mùi vị. Tên gọi của X, Y lần lượt là A. fructozơ và tinh bột. B. fructozơ và xenlulozơ. C. glucozơ và xenlulozơ. D. glucozơ và tinh bột. Câu 27:(VD) Hòa tan hoàn toàn 11,0 gam hỗn hợp X gồm Zn và Cu bằng dung dịch H 2SO4 loãng dư, thu được 0,12 mol khí H2. Số mol Cu trong 11,0 gam X là A. 0,05 mol B. 0,06 mol. C. 0,12 mol. D. 0,1 mol. Câu 28:(VD) Chất X (có M = 60 và chứa C, H, O). Chất X phản ứng được với dung dịch NaOH đun nóng. X không tác dụng Na, NaHCO3. Tên gọi của X là A. metyl fomat. B. etyl axetat. C. ancol propylic. D. axit axetic. Câu 29:(TH) Cho kim loại Fe lần lượt phản ứng với các dung dịch: FeCl3, Cu(NO3)2, AgNO3, MgCl2. Số trường hợp xảy ra phản ứng hóa học là A. 4. B. 3. C. 1. D. 2. Câu 30:(VD) Đốt hoàn toàn 4,2 gam một este E thu được 6,16 gam CO 2 và 2,52 gam H2O. Công thức cấu tạo của E là A. HCOOC2H5.B. CH 3COOC2H5. C. CH3COOCH3. D. HCOOCH3. Câu 31:(TH) Cho các phát biểu sau: (a) Thủy phân este trong môi trường kiềm gọi là phản ứng xà phòng hóa. (b) Các este có nhiệt độ sôi thấp hơn axit và ancol có cùng số nguyên tử cacbon. (c) Poliisopren là hiđrocacbon. (d) Có thể dùng Cu(OH)2 để phân biệt Ala-Ala và Ala-Ala-Ala.
  3. (e) Tơ nilon-6,6 được trùng hợp bởi hexametylenđiamin và axit ađipic. (g) Chất béo lỏng dễ bị oxi hóa bởi oxi không khí hơn chất béo rắn. Số phát biểu đúng là A. 3. B. 4. C. 5. D. 6. Câu 32:(TH) Thực hiện các thí nghiệm sau: (a) Cho dung dịch BaCl2 vào dung dịch KHSO4. (b) Cho dung dịch NaOH vào dung dịch Ca(HCO3)2. (c) Cho dung dịch NH3 tới dư vào dung dịch Fe(NO3)3. (d) Cho dung dịch NaOH tới dư vào dung dịch AlCl3. (e) Cho kim loại Cu vào dung dịch FeCl3 dư. Sau khi các phản ứng kết thúc, số thí nghiệm thu được kết tủa là A. 3. B. 4. C. 2. D. 5. Câu 33:(VD) Hỗn hợp amoni peclorat (NH4ClO4) và bột nhôm (Al) là nhiên liệu rắn của tàu vũ trụ con thoi theo phản ứng sau: NH4ClO4  N2 + Cl2 + O2 + H2O Mỗi một lần phóng tàu con thoi tiêu tốn 750 tấn amoni peclorat (NH4ClO4). Giả sử tất cả khí oxi (O2) sinh ra tác dụng hoàn toàn với bột nhôm (Al). Khối lượng bột nhôm đã tham gia phản ứng gần nhất với giá trị nào sau đây? A. 245 tấn. B. 268 tấn. C. 230 tấn. D. 250 tấn. Câu 34:(VD) Đốt cháy hoàn toàn a gam chất béo X (chứa triglixerit của axit stearic, axit panmitic và các axit béo tự do đó) cần vừa đủ 18,816 lít O 2 (đktc). Sau phản ứng thu được 13,44 lít CO2 (đktc) và 10,44 gam nước. Xà phòng hoá a gam X bằng NaOH vừa đủ thì thu được m gam muối. Giá trị của m là A. 10,68. B. 11,48. C. 11,04. D. 11,84. Câu 35:(VD) Cho biết để đưa 1 gam nước lên 10C thì cần 4,184 J. Muốn đun sôi 1 lít nước từ 250C đến 1000C thì cần đốt bao nhiêu lít khí butan (ga đun bếp) ở đktc, biết rằng 1 mol butan cháy tỏa ra 2807,2 kJ (khối lượng riêng của nước là 1g/ml)? A. 2,44 lít.B. 2,24 lít.C. 4,48 lít.D. 5,6 lít. Câu 36:(VDC) Cho m gam hỗn hợp Mg, Al, Al2O3, Fe3O4 (trong đó oxi chiếm 25% về khối lượng) phản ứng vừa đủ trong 196 gam dung dịch H2SO4 42,5% đun nóng nhẹ, sau phản ứng thu được một phần chất rắn không tan và 5,6 lít hỗn hợp hai khí H 2 và SO2 có tỉ khối so với He là 9,8. Phần dung dịch thu được đem cho tác dụng với dung dịch NH 3 dư, thu được 43,14 gam kết tủa. Giá trị của m là A. 34,40. B. 26,24. C. 32,00. D. 28,00. Câu 37:(VDC) Hỗn hợp E gồm một axit đa chức X và một hợp chất hữu cơ tạp chức Y đều có thành phần chứa các nguyên tố C, H, O. Tiến hành ba thí nghiệm với m gam hỗn hợp E: - Thí nghiệm 1: Phản ứng hoàn toàn với lượng dư AgNO3 trong NH3, thu được 43,2 gam Ag. - Thí nghiệm 2: Phản ứng vừa đủ với 100 ml dung dịch KHCO3 2M. - Thí nghiệm 3: Phản ứng vừa đủ với 100 ml dung dịch KOH 4M, thu được 1 ancol duy nhất Z và hỗn hợp T gồm hai muối. Dẫn toàn bộ Z qua bình đựng Na dư, thấy khối lượng bình tăng 9 gam, đồng thời thu được 0,1 mol khí H2. Đốt cháy hoàn toàn hỗn hợp T bằng lượng O2 vừa đủ, thu được 0,4 mol CO2, nước và muối cacbonat. Phần trăm khối lượng của Y trong hỗn hợp E có giá trị gần nhất với giá trị nào sau đây? A. 30,5%. B. 69,5%. C. 31,0%. D. 69,0 %.
  4. Câu 38:(VDC) Điện phân dung dịch chứa Cu(NO3)2, CuSO4 và NaCl với điện cực trơ, cường độ dòng điện không đổi 2A, hiệu suất 100%. Kết quả thí nghiệm được ghi trong bảng sau: Thời gian điện phân (giây) t t + 2895 2t Tổng số mol khí ở 2 điện cực a a + 0,03 2,125a Số mol Cu ở catot b b + 0,02 b + 0,02 Giá trị của t là A. 4825B. 3860C. 2895D. 5790 Câu 39:(VD) Cho chuyển hóa sau: X NaAlO2 Y Z Al. Các chất X, Y, Z không phù hợp với sơ đồ trên là A. Al2O3; Al(OH)3; AlCl3. B. Al(OH)3; Al2(SO4)3; AlCl3. C. Al, Al(OH)3; Al2O3. D. Al2O3; AlCl3; Al2O3. Câu 40:(VDC) Cho các chất hữu cơ X, Y, Z, T, E thỏa mãn các phương trình hóa học sau: t0 (1) X + 3NaOH  C6H5ONa + Y + CH3CHO + H2O CaO,t0 (2) Y + 2NaOH  T + 2Na2CO3 t0 (3) CH3CHO + 2AgNO3 + 3NH3 + H2O  Z + 0 (4) Z + NaOH t E + CaO,t0 (5) E + NaOH  T + Na2CO3 Công thức phân tử của X là công thức nào sau đây? A. C12H20O6. B. C 12H14O4. C. C 11H10O4. D. C 11H12O4. HẾT